C26H32Cl2N2O2 — CID 143538355
1-chloro-3-methylbenzene;(2S)-N-(3-chlorophenyl)-2-[(E)-hept-2-en-3-yl]-6-oxopiperidine-3-carboxamide (PubChem CID 143538355) has the molecular formula C26H32Cl2N2O2 and a molecular weight of 475.46 g/mol. Its IUPAC name is 1-chloro-3-methylbenzene;(2S)-N-(3-chlorophenyl)-2-[(E)-hept-2-en-3-yl]-6-oxopiperidine-3-carboxamide.
| Compound Name | 1-chloro-3-methylbenzene;(2S)-N-(3-chlorophenyl)-2-[(E)-hept-2-en-3-yl]-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 143538355 |
| Molecular Formula | C26H32Cl2N2O2 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 1-chloro-3-methylbenzene;(2S)-N-(3-chlorophenyl)-2-[(E)-hept-2-en-3-yl]-6-oxopiperidine-3-carboxamide |
| SMILES | C/C=C(\CCCC)[C@H]1NC(=O)CCC1C(=O)Nc1cccc(Cl)c1.Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H25ClN2O2.C7H7Cl/c1-3-5-7-13(4-2)18-16(10-11-17(23)22-18)19(24)21-15-9-6-8-14(20)12-15;1-6-3-2-4-7(8)5-6/h4,6,8-9,12,16,18H,3,5,7,10-11H2,1-2H3,(H,21,24)(H,22,23);2-5H,1H3/b13-4+;/t16?,18-;/m1./s1 |
| InChIKey | PDLXQSIIRZQNFF-PECRETLMSA-N |
| XLogP | 6.96 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|