C18H25ClN2O2 — CID 163686162
(3R)-N-(3-chlorophenyl)-7-oxo-1-pentan-2-ylazepane-3-carboxamide (PubChem CID 163686162) has the molecular formula C18H25ClN2O2 and a molecular weight of 336.86 g/mol. Its IUPAC name is (3R)-N-(3-chlorophenyl)-7-oxo-1-pentan-2-ylazepane-3-carboxamide.
| Compound Name | (3R)-N-(3-chlorophenyl)-7-oxo-1-pentan-2-ylazepane-3-carboxamide |
|---|---|
| PubChem CID | 163686162 |
| Molecular Formula | C18H25ClN2O2 |
| Molecular Weight | 336.86 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | (3R)-N-(3-chlorophenyl)-7-oxo-1-pentan-2-ylazepane-3-carboxamide |
| SMILES | CCCC(C)N1C[C@H](C(=O)Nc2cccc(Cl)c2)CCCC1=O |
| InChI | InChI=1S/C18H25ClN2O2/c1-3-6-13(2)21-12-14(7-4-10-17(21)22)18(23)20-16-9-5-8-15(19)11-16/h5,8-9,11,13-14H,3-4,6-7,10,12H2,1-2H3,(H,20,23)/t13?,14-/m1/s1 |
| InChIKey | JPAXJOMDKQZXRW-ARLHGKGLSA-N |
| XLogP | 4.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.86 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |