C10H8O4 — CID 123728474
1-(3,6-dihydroxy-1-benzofuran-7-yl)ethanone (PubChem CID 123728474) has the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. Its IUPAC name is 1-(3,6-dihydroxy-1-benzofuran-7-yl)ethanone.
| Compound Name | 1-(3,6-dihydroxy-1-benzofuran-7-yl)ethanone |
|---|---|
| PubChem CID | 123728474 |
| Molecular Formula | C10H8O4 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 1-(3,6-dihydroxy-1-benzofuran-7-yl)ethanone |
| SMILES | CC(=O)c1c(O)ccc2c(O)coc12 |
| InChI | InChI=1S/C10H8O4/c1-5(11)9-7(12)3-2-6-8(13)4-14-10(6)9/h2-4,12-13H,1H3 |
| InChIKey | BUHZCYHUFNKQHN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |