C9H8O4 — CID 123234995
6-methoxy-1-benzofuran-3,7-diol (PubChem CID 123234995) has the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. Its IUPAC name is 6-methoxy-1-benzofuran-3,7-diol.
| Compound Name | 6-methoxy-1-benzofuran-3,7-diol |
|---|---|
| PubChem CID | 123234995 |
| Molecular Formula | C9H8O4 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 6-methoxy-1-benzofuran-3,7-diol |
| SMILES | COc1ccc2c(O)coc2c1O |
| InChI | InChI=1S/C9H8O4/c1-12-7-3-2-5-6(10)4-13-9(5)8(7)11/h2-4,10-11H,1H3 |
| InChIKey | OZRVJGBUOAVGOM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |