C25H43NO — CID 123728504
3,7-dimethyl-N-[2-[(2-propan-2-yl-2-adamantyl)oxy]ethyl]octa-2,6-dien-1-amine (PubChem CID 123728504) has the molecular formula C25H43NO and a molecular weight of 373.63 g/mol. Its IUPAC name is 3,7-dimethyl-N-[2-[(2-propan-2-yl-2-adamantyl)oxy]ethyl]octa-2,6-dien-1-amine.
| Compound Name | 3,7-dimethyl-N-[2-[(2-propan-2-yl-2-adamantyl)oxy]ethyl]octa-2,6-dien-1-amine |
|---|---|
| PubChem CID | 123728504 |
| Molecular Formula | C25H43NO |
| Molecular Weight | 373.63 g/mol |
| Exact Mass | 373.33 |
| IUPAC Name | 3,7-dimethyl-N-[2-[(2-propan-2-yl-2-adamantyl)oxy]ethyl]octa-2,6-dien-1-amine |
| SMILES | CC(C)=CCCC(C)=CCNCCOC1(C(C)C)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C25H43NO/c1-18(2)7-6-8-20(5)9-10-26-11-12-27-25(19(3)4)23-14-21-13-22(16-23)17-24(25)15-21/h7,9,19,21-24,26H,6,8,10-17H2,1-5H3 |
| InChIKey | AYIFYKUBNIXXRZ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.63 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|