About N-[2-(1,2-dimethylcyclopropyl)ethyl]propan-2-amine
N-[2-(1,2-dimethylcyclopropyl)ethyl]propan-2-amine (PubChem CID 123728566) has the molecular formula C10H21N
and a molecular weight of 155.28 g/mol. Its IUPAC name is N-[2-(1,2-dimethylcyclopropyl)ethyl]propan-2-amine.
Analyze N-[2-(1,2-dimethylcyclopropyl)ethyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1,2-dimethylcyclopropyl)ethyl]propan-2-amine?
The IUPAC name of N-[2-(1,2-dimethylcyclopropyl)ethyl]propan-2-amine (CID 123728566) is N-[2-(1,2-dimethylcyclopropyl)ethyl]propan-2-amine.
What is the SMILES notation for N-[2-(1,2-dimethylcyclopropyl)ethyl]propan-2-amine?
The canonical SMILES for N-[2-(1,2-dimethylcyclopropyl)ethyl]propan-2-amine is CC(C)NCCC1(C)CC1C.
What is the InChIKey of N-[2-(1,2-dimethylcyclopropyl)ethyl]propan-2-amine?
The InChIKey is NIRYCBHTVXAYJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N/c1-8(2)11-6-5-10(4)7-9(10)3/h8-9,11H,5-7H2,1-4H3.
What are the key properties of N-[2-(1,2-dimethylcyclopropyl)ethyl]propan-2-amine?
N-[2-(1,2-dimethylcyclopropyl)ethyl]propan-2-amine has a molecular weight of 155.28 g/mol, XLogP of 2.42, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1,2-dimethylcyclopropyl)ethyl]propan-2-amine is sourced from PubChem (CID 123728566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).