C9H17+ — CID 123459221
1,2-dimethyl-1-(2-methylpropyl)cyclopropane (PubChem CID 123459221) has the molecular formula C9H17+ and a molecular weight of 125.23 g/mol. Its IUPAC name is 1,2-dimethyl-1-(2-methylpropyl)cyclopropane.
| Compound Name | 1,2-dimethyl-1-(2-methylpropyl)cyclopropane |
|---|---|
| PubChem CID | 123459221 |
| Molecular Formula | C9H17+ |
| Molecular Weight | 125.23 g/mol |
| Exact Mass | 125.13 |
| IUPAC Name | 1,2-dimethyl-1-(2-methylpropyl)cyclopropane |
| SMILES | C[C+](C)CC1(C)CC1C |
| InChI | InChI=1S/C9H17/c1-7(2)5-9(4)6-8(9)3/h8H,5-6H2,1-4H3/q+1 |
| InChIKey | FVSYNZHGWQTFBO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.23 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|