C18H36 — CID 123729165
2-decan-4-yl-1,4-dimethylcyclohexane (PubChem CID 123729165) has the molecular formula C18H36 and a molecular weight of 252.49 g/mol. Its IUPAC name is 2-decan-4-yl-1,4-dimethylcyclohexane.
| Compound Name | 2-decan-4-yl-1,4-dimethylcyclohexane |
|---|---|
| PubChem CID | 123729165 |
| Molecular Formula | C18H36 |
| Molecular Weight | 252.49 g/mol |
| Exact Mass | 252.28 |
| IUPAC Name | 2-decan-4-yl-1,4-dimethylcyclohexane |
| SMILES | CCCCCCC(CCC)C1CC(C)CCC1C |
| InChI | InChI=1S/C18H36/c1-5-7-8-9-11-17(10-6-2)18-14-15(3)12-13-16(18)4/h15-18H,5-14H2,1-4H3 |
| InChIKey | MRQFNTKELCWASY-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.49 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|