C16H32O2 — CID 134492565
(2S,3S)-6-decan-4-yl-2-methyloxan-3-ol (PubChem CID 134492565) has the molecular formula C16H32O2 and a molecular weight of 256.43 g/mol. Its IUPAC name is (2S,3S)-6-decan-4-yl-2-methyloxan-3-ol.
| Compound Name | (2S,3S)-6-decan-4-yl-2-methyloxan-3-ol |
|---|---|
| PubChem CID | 134492565 |
| Molecular Formula | C16H32O2 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.24 |
| IUPAC Name | (2S,3S)-6-decan-4-yl-2-methyloxan-3-ol |
| SMILES | CCCCCCC(CCC)C1CC[C@H](O)[C@H](C)O1 |
| InChI | InChI=1S/C16H32O2/c1-4-6-7-8-10-14(9-5-2)16-12-11-15(17)13(3)18-16/h13-17H,4-12H2,1-3H3/t13-,14?,15-,16?/m0/s1 |
| InChIKey | PUFMBBJRMQVWDO-UIDBIOKJSA-N |
| XLogP | 4.30 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|