About 3-undecan-5-yldioxolane
3-undecan-5-yldioxolane (PubChem CID 88733084) has the molecular formula C14H28O2
and a molecular weight of 228.38 g/mol. Its IUPAC name is 3-undecan-5-yldioxolane.
Molecular Properties
| Compound Name | 3-undecan-5-yldioxolane |
| PubChem CID | 88733084 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 3-undecan-5-yldioxolane |
| SMILES | CCCCCCC(CCCC)C1CCOO1 |
| InChI | InChI=1S/C14H28O2/c1-3-5-7-8-10-13(9-6-4-2)14-11-12-15-16-14/h13-14H,3-12H2,1-2H3 |
| InChIKey | PAYYUTNDTRDNRY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-undecan-5-yldioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-undecan-5-yldioxolane?
The IUPAC name of 3-undecan-5-yldioxolane (CID 88733084) is 3-undecan-5-yldioxolane.
What is the SMILES notation for 3-undecan-5-yldioxolane?
The canonical SMILES for 3-undecan-5-yldioxolane is CCCCCCC(CCCC)C1CCOO1.
What is the InChIKey of 3-undecan-5-yldioxolane?
The InChIKey is PAYYUTNDTRDNRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O2/c1-3-5-7-8-10-13(9-6-4-2)14-11-12-15-16-14/h13-14H,3-12H2,1-2H3.
What are the key properties of 3-undecan-5-yldioxolane?
3-undecan-5-yldioxolane has a molecular weight of 228.38 g/mol, XLogP of 4.48, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-undecan-5-yldioxolane is sourced from PubChem (CID 88733084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).