About 3-tridecan-7-yloxetane
3-tridecan-7-yloxetane (PubChem CID 130235812) has the molecular formula C16H32O
and a molecular weight of 240.43 g/mol. Its IUPAC name is 3-tridecan-7-yloxetane.
Molecular Properties
| Compound Name | 3-tridecan-7-yloxetane |
| PubChem CID | 130235812 |
| Molecular Formula | C16H32O |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.25 |
| IUPAC Name | 3-tridecan-7-yloxetane |
| SMILES | CCCCCCC(CCCCCC)C1COC1 |
| InChI | InChI=1S/C16H32O/c1-3-5-7-9-11-15(16-13-17-14-16)12-10-8-6-4-2/h15-16H,3-14H2,1-2H3 |
| InChIKey | ISKOHIAGJVWFAW-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-tridecan-7-yloxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tridecan-7-yloxetane?
The IUPAC name of 3-tridecan-7-yloxetane (CID 130235812) is 3-tridecan-7-yloxetane.
What is the SMILES notation for 3-tridecan-7-yloxetane?
The canonical SMILES for 3-tridecan-7-yloxetane is CCCCCCC(CCCCCC)C1COC1.
What is the InChIKey of 3-tridecan-7-yloxetane?
The InChIKey is ISKOHIAGJVWFAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O/c1-3-5-7-9-11-15(16-13-17-14-16)12-10-8-6-4-2/h15-16H,3-14H2,1-2H3.
What are the key properties of 3-tridecan-7-yloxetane?
3-tridecan-7-yloxetane has a molecular weight of 240.43 g/mol, XLogP of 5.19, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tridecan-7-yloxetane is sourced from PubChem (CID 130235812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).