About CID 123729735
CID 123729735 (PubChem CID 123729735) has the molecular formula C23H18FN4O4S2-
and a molecular weight of 497.55 g/mol.
Molecular Properties
| Compound Name | CID 123729735 |
| PubChem CID | 123729735 |
| Molecular Formula | C23H18FN4O4S2- |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.08 |
| IUPAC Name | — |
| SMILES | C=[S-](=O)NC(=O)c1cc2nccc(Oc3ccc(NC(=O)Nc4cc(C)ccc4F)cc3)c2s1 |
| InChI | InChI=1S/C23H18FN4O4S2/c1-13-3-8-16(24)17(11-13)27-23(30)26-14-4-6-15(7-5-14)32-19-9-10-25-18-12-20(33-21(18)19)22(29)28-34(2)31/h3-12H,2H2,1H3,(H2,26,27,30)(H,28,29,31)/q-1 |
| InChIKey | JCGIJCROUUUKKG-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze CID 123729735 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 123729735?
The IUPAC name of CID 123729735 (CID 123729735) is not available.
What is the SMILES notation for CID 123729735?
The canonical SMILES for CID 123729735 is C=[S-](=O)NC(=O)c1cc2nccc(Oc3ccc(NC(=O)Nc4cc(C)ccc4F)cc3)c2s1.
What is the InChIKey of CID 123729735?
The InChIKey is JCGIJCROUUUKKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18FN4O4S2/c1-13-3-8-16(24)17(11-13)27-23(30)26-14-4-6-15(7-5-14)32-19-9-10-25-18-12-20(33-21(18)19)22(29)28-34(2)31/h3-12H,2H2,1H3,(H2,26,27,30)(H,28,29,31)/q-1.
What are the key properties of CID 123729735?
CID 123729735 has a molecular weight of 497.55 g/mol, XLogP of 5.22, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 123729735 is sourced from PubChem (CID 123729735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).