C23H18FN4O4S2- — CID 123729735
CID 123729735 (PubChem CID 123729735) has the molecular formula C23H18FN4O4S2- and a molecular weight of 497.55 g/mol.
| Compound Name | CID 123729735 |
|---|---|
| PubChem CID | 123729735 |
| Molecular Formula | C23H18FN4O4S2- |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.08 |
| IUPAC Name | — |
| SMILES | C=[S-](=O)NC(=O)c1cc2nccc(Oc3ccc(NC(=O)Nc4cc(C)ccc4F)cc3)c2s1 |
| InChI | InChI=1S/C23H18FN4O4S2/c1-13-3-8-16(24)17(11-13)27-23(30)26-14-4-6-15(7-5-14)32-19-9-10-25-18-12-20(33-21(18)19)22(29)28-34(2)31/h3-12H,2H2,1H3,(H2,26,27,30)(H,28,29,31)/q-1 |
| InChIKey | JCGIJCROUUUKKG-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|