C27H25FN4O6S2 — CID 123263638
4-[[[7-[4-[(2-fluoro-5-methylphenyl)carbamoylamino]phenoxy]thieno[3,2-b]pyridine-2-carbonyl]amino]-methyl-oxo-λ6-sulfanylidene]butanoic acid (PubChem CID 123263638) has the molecular formula C27H25FN4O6S2 and a molecular weight of 584.65 g/mol. Its IUPAC name is 4-[[[7-[4-[(2-fluoro-5-methylphenyl)carbamoylamino]phenoxy]thieno[3,2-b]pyridine-2-carbonyl]amino]-methyl-oxo-λ6-sulfanylidene]butanoic acid.
| Compound Name | 4-[[[7-[4-[(2-fluoro-5-methylphenyl)carbamoylamino]phenoxy]thieno[3,2-b]pyridine-2-carbonyl]amino]-methyl-oxo-λ6-sulfanylidene]butanoic acid |
|---|---|
| PubChem CID | 123263638 |
| Molecular Formula | C27H25FN4O6S2 |
| Molecular Weight | 584.65 g/mol |
| Exact Mass | 584.12 |
| IUPAC Name | 4-[[[7-[4-[(2-fluoro-5-methylphenyl)carbamoylamino]phenoxy]thieno[3,2-b]pyridine-2-carbonyl]amino]-methyl-oxo-λ6-sulfanylidene]butanoic acid |
| SMILES | Cc1ccc(F)c(NC(=O)Nc2ccc(Oc3ccnc4cc(C(=O)NS(C)(=O)=CCCC(=O)O)sc34)cc2)c1 |
| InChI | InChI=1S/C27H25FN4O6S2/c1-16-5-10-19(28)20(14-16)31-27(36)30-17-6-8-18(9-7-17)38-22-11-12-29-21-15-23(39-25(21)22)26(35)32-40(2,37)13-3-4-24(33)34/h5-15H,3-4H2,1-2H3,(H,33,34)(H2,30,31,36)(H,32,35,37) |
| InChIKey | RBSSVRQQZZGFAM-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 146.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.65 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|