C29H29N5O6S — CID 123910439
4-[methyl-[[5-[4-[4-[(3-methylphenyl)carbamoylamino]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carbonyl]amino]-oxo-λ6-sulfanylidene]butanoic acid (PubChem CID 123910439) has the molecular formula C29H29N5O6S and a molecular weight of 575.65 g/mol. Its IUPAC name is 4-[methyl-[[5-[4-[4-[(3-methylphenyl)carbamoylamino]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carbonyl]amino]-oxo-λ6-sulfanylidene]butanoic acid.
| Compound Name | 4-[methyl-[[5-[4-[4-[(3-methylphenyl)carbamoylamino]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carbonyl]amino]-oxo-λ6-sulfanylidene]butanoic acid |
|---|---|
| PubChem CID | 123910439 |
| Molecular Formula | C29H29N5O6S |
| Molecular Weight | 575.65 g/mol |
| Exact Mass | 575.18 |
| IUPAC Name | 4-[methyl-[[5-[4-[4-[(3-methylphenyl)carbamoylamino]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carbonyl]amino]-oxo-λ6-sulfanylidene]butanoic acid |
| SMILES | Cc1cccc(NC(=O)Nc2ccc(Oc3ccnc(-c4cc(C(=O)NS(C)(=O)=CCCC(=O)O)c[nH]4)c3)cc2)c1 |
| InChI | InChI=1S/C29H29N5O6S/c1-19-5-3-6-22(15-19)33-29(38)32-21-8-10-23(11-9-21)40-24-12-13-30-26(17-24)25-16-20(18-31-25)28(37)34-41(2,39)14-4-7-27(35)36/h3,5-6,8-18,31H,4,7H2,1-2H3,(H,35,36)(H2,32,33,38)(H,34,37,39) |
| InChIKey | DQFWCLYEHYAVNZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 162.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.65 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|