C31H35N5O5 — CID 71542643
N-(3,3-diethoxypropyl)-5-[4-[4-[(3-methylphenyl)carbamoylamino]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carboxamide (PubChem CID 71542643) has the molecular formula C31H35N5O5 and a molecular weight of 557.65 g/mol. Its IUPAC name is N-(3,3-diethoxypropyl)-5-[4-[4-[(3-methylphenyl)carbamoylamino]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carboxamide.
| Compound Name | N-(3,3-diethoxypropyl)-5-[4-[4-[(3-methylphenyl)carbamoylamino]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 71542643 |
| Molecular Formula | C31H35N5O5 |
| Molecular Weight | 557.65 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | N-(3,3-diethoxypropyl)-5-[4-[4-[(3-methylphenyl)carbamoylamino]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carboxamide |
| SMILES | CCOC(CCNC(=O)c1c[nH]c(-c2cc(Oc3ccc(NC(=O)Nc4cccc(C)c4)cc3)ccn2)c1)OCC |
| InChI | InChI=1S/C31H35N5O5/c1-4-39-29(40-5-2)14-16-33-30(37)22-18-27(34-20-22)28-19-26(13-15-32-28)41-25-11-9-23(10-12-25)35-31(38)36-24-8-6-7-21(3)17-24/h6-13,15,17-20,29,34H,4-5,14,16H2,1-3H3,(H,33,37)(H2,35,36,38) |
| InChIKey | OQDFRTWWEAKNRG-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 126.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.65 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|