C32H33FN6O6 — CID 123939095
6-(ethylamino)-4-[[5-[4-[3-fluoro-4-[(3-methylphenyl)carbamoylamino]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carbonyl]amino]-6-oxohexanoic acid (PubChem CID 123939095) has the molecular formula C32H33FN6O6 and a molecular weight of 616.65 g/mol. Its IUPAC name is 6-(ethylamino)-4-[[5-[4-[3-fluoro-4-[(3-methylphenyl)carbamoylamino]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carbonyl]amino]-6-oxohexanoic acid.
| Compound Name | 6-(ethylamino)-4-[[5-[4-[3-fluoro-4-[(3-methylphenyl)carbamoylamino]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carbonyl]amino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 123939095 |
| Molecular Formula | C32H33FN6O6 |
| Molecular Weight | 616.65 g/mol |
| Exact Mass | 616.24 |
| IUPAC Name | 6-(ethylamino)-4-[[5-[4-[3-fluoro-4-[(3-methylphenyl)carbamoylamino]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carbonyl]amino]-6-oxohexanoic acid |
| SMILES | CCNC(=O)CC(CCC(=O)O)NC(=O)c1c[nH]c(-c2cc(Oc3ccc(NC(=O)Nc4cccc(C)c4)c(F)c3)ccn2)c1 |
| InChI | InChI=1S/C32H33FN6O6/c1-3-34-29(40)15-22(7-10-30(41)42)37-31(43)20-14-27(36-18-20)28-17-24(11-12-35-28)45-23-8-9-26(25(33)16-23)39-32(44)38-21-6-4-5-19(2)13-21/h4-6,8-9,11-14,16-18,22,36H,3,7,10,15H2,1-2H3,(H,34,40)(H,37,43)(H,41,42)(H2,38,39,44) |
| InChIKey | JVHOVXXGQUNSGT-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 174.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.65 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |