C29H29N5O6S — CID 91663797
methyl 3-[methyl-[[5-[4-[4-[(3-methylphenyl)carbamoylamino]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carbonyl]amino]-oxo-λ6-sulfanylidene]propanoate (PubChem CID 91663797) has the molecular formula C29H29N5O6S and a molecular weight of 575.65 g/mol. Its IUPAC name is methyl 3-[methyl-[[5-[4-[4-[(3-methylphenyl)carbamoylamino]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carbonyl]amino]-oxo-λ6-sulfanylidene]propanoate.
| Compound Name | methyl 3-[methyl-[[5-[4-[4-[(3-methylphenyl)carbamoylamino]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carbonyl]amino]-oxo-λ6-sulfanylidene]propanoate |
|---|---|
| PubChem CID | 91663797 |
| Molecular Formula | C29H29N5O6S |
| Molecular Weight | 575.65 g/mol |
| Exact Mass | 575.18 |
| IUPAC Name | methyl 3-[methyl-[[5-[4-[4-[(3-methylphenyl)carbamoylamino]phenoxy]-2-pyridinyl]-1H-pyrrole-3-carbonyl]amino]-oxo-λ6-sulfanylidene]propanoate |
| SMILES | COC(=O)CC=S(C)(=O)NC(=O)c1c[nH]c(-c2cc(Oc3ccc(NC(=O)Nc4cccc(C)c4)cc3)ccn2)c1 |
| InChI | InChI=1S/C29H29N5O6S/c1-19-5-4-6-22(15-19)33-29(37)32-21-7-9-23(10-8-21)40-24-11-13-30-26(17-24)25-16-20(18-31-25)28(36)34-41(3,38)14-12-27(35)39-2/h4-11,13-18,31H,12H2,1-3H3,(H2,32,33,37)(H,34,36,38) |
| InChIKey | CRHBZPLOTMMEGI-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 151.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.65 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|