C24H25N6O2+ — CID 123729829
[1-[6-[4-(4-cyano-2-methylphenyl)-3-oxo-1H-pyrazol-2-yl]pyridine-3-carbonyl]pyrrolidin-3-yl]methylidene-dimethylazanium (PubChem CID 123729829) has the molecular formula C24H25N6O2+ and a molecular weight of 429.50 g/mol. Its IUPAC name is [1-[6-[4-(4-cyano-2-methylphenyl)-3-oxo-1H-pyrazol-2-yl]pyridine-3-carbonyl]pyrrolidin-3-yl]methylidene-dimethylazanium.
| Compound Name | [1-[6-[4-(4-cyano-2-methylphenyl)-3-oxo-1H-pyrazol-2-yl]pyridine-3-carbonyl]pyrrolidin-3-yl]methylidene-dimethylazanium |
|---|---|
| PubChem CID | 123729829 |
| Molecular Formula | C24H25N6O2+ |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | [1-[6-[4-(4-cyano-2-methylphenyl)-3-oxo-1H-pyrazol-2-yl]pyridine-3-carbonyl]pyrrolidin-3-yl]methylidene-dimethylazanium |
| SMILES | Cc1cc(C#N)ccc1-c1c[nH]n(-c2ccc(C(=O)N3CCC(C=[N+](C)C)C3)cn2)c1=O |
| InChI | InChI=1S/C24H24N6O2/c1-16-10-17(11-25)4-6-20(16)21-13-27-30(24(21)32)22-7-5-19(12-26-22)23(31)29-9-8-18(15-29)14-28(2)3/h4-7,10,12-14,18H,8-9,15H2,1-3H3/p+1 |
| InChIKey | WZDOUEGLIVWPKF-UHFFFAOYSA-O |
| XLogP | 2.21 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|