C21H38N2 — CID 123730506
N-[(6-hexa-2,4-dien-2-yl-6-azaspiro[2.5]octan-2-yl)methyl]heptan-2-amine (PubChem CID 123730506) has the molecular formula C21H38N2 and a molecular weight of 318.55 g/mol. Its IUPAC name is N-[(6-hexa-2,4-dien-2-yl-6-azaspiro[2.5]octan-2-yl)methyl]heptan-2-amine.
| Compound Name | N-[(6-hexa-2,4-dien-2-yl-6-azaspiro[2.5]octan-2-yl)methyl]heptan-2-amine |
|---|---|
| PubChem CID | 123730506 |
| Molecular Formula | C21H38N2 |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.30 |
| IUPAC Name | N-[(6-hexa-2,4-dien-2-yl-6-azaspiro[2.5]octan-2-yl)methyl]heptan-2-amine |
| SMILES | CC=CC=C(C)N1CCC2(CC1)CC2CNC(C)CCCCC |
| InChI | InChI=1S/C21H38N2/c1-5-7-9-10-18(3)22-17-20-16-21(20)12-14-23(15-13-21)19(4)11-8-6-2/h6,8,11,18,20,22H,5,7,9-10,12-17H2,1-4H3 |
| InChIKey | DMMRMMOCUCHFRM-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|