C17H25FN5O4S+ — CID 123730723
2-[[6-(5-amino-3-propylsulfanyl-2,4,7-triaza-8-azoniabicyclo[4.2.0]octa-1,3,5,7-tetraen-8-yl)-5-fluoro-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy]ethanol (PubChem CID 123730723) has the molecular formula C17H25FN5O4S+ and a molecular weight of 414.48 g/mol. Its IUPAC name is 2-[[6-(5-amino-3-propylsulfanyl-2,4,7-triaza-8-azoniabicyclo[4.2.0]octa-1,3,5,7-tetraen-8-yl)-5-fluoro-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy]ethanol.
| Compound Name | 2-[[6-(5-amino-3-propylsulfanyl-2,4,7-triaza-8-azoniabicyclo[4.2.0]octa-1,3,5,7-tetraen-8-yl)-5-fluoro-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy]ethanol |
|---|---|
| PubChem CID | 123730723 |
| Molecular Formula | C17H25FN5O4S+ |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 2-[[6-(5-amino-3-propylsulfanyl-2,4,7-triaza-8-azoniabicyclo[4.2.0]octa-1,3,5,7-tetraen-8-yl)-5-fluoro-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy]ethanol |
| SMILES | CCCSc1nc(N)c2c(n1)[N+](C1C(F)C(OCCO)C3OC(C)(C)OC31)=N2 |
| InChI | InChI=1S/C17H24FN5O4S/c1-4-7-28-16-20-14(19)9-15(21-16)23(22-9)10-8(18)11(25-6-5-24)13-12(10)26-17(2,3)27-13/h8,10-13,19,24H,4-7H2,1-3H3/p+1 |
| InChIKey | UQBPNPCGAIGBOC-UHFFFAOYSA-O |
| XLogP | 1.92 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|