C41H73N3O8 — CID 123732481
octyl 4-[3-(3-amino-1-hydroxypropoxy)-7,12-bis(3-aminopropanoyloxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 123732481) has the molecular formula C41H73N3O8 and a molecular weight of 736.05 g/mol. Its IUPAC name is octyl 4-[3-(3-amino-1-hydroxypropoxy)-7,12-bis(3-aminopropanoyloxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | octyl 4-[3-(3-amino-1-hydroxypropoxy)-7,12-bis(3-aminopropanoyloxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 123732481 |
| Molecular Formula | C41H73N3O8 |
| Molecular Weight | 736.05 g/mol |
| Exact Mass | 735.54 |
| IUPAC Name | octyl 4-[3-(3-amino-1-hydroxypropoxy)-7,12-bis(3-aminopropanoyloxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | CCCCCCCCOC(=O)CCC(C)C1CCC2C3C(OC(=O)CCN)CC4CC(OC(O)CCN)CCC4(C)C3CC(OC(=O)CCN)C12C |
| InChI | InChI=1S/C41H73N3O8/c1-5-6-7-8-9-10-23-49-35(45)14-11-27(2)30-12-13-31-39-32(26-34(41(30,31)4)52-38(48)18-22-44)40(3)19-15-29(50-36(46)16-20-42)24-28(40)25-33(39)51-37(47)17-21-43/h27-34,36,39,46H,5-26,42-44H2,1-4H3 |
| InChIKey | APZCYPCFUYSJRE-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 186.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.05 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|