C37H65NO4 — CID 155176773
decyl (4R)-4-[(5S,7R,8R,10S,13R)-7-(3-aminopropanoyloxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 155176773) has the molecular formula C37H65NO4 and a molecular weight of 587.93 g/mol. Its IUPAC name is decyl (4R)-4-[(5S,7R,8R,10S,13R)-7-(3-aminopropanoyloxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | decyl (4R)-4-[(5S,7R,8R,10S,13R)-7-(3-aminopropanoyloxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 155176773 |
| Molecular Formula | C37H65NO4 |
| Molecular Weight | 587.93 g/mol |
| Exact Mass | 587.49 |
| IUPAC Name | decyl (4R)-4-[(5S,7R,8R,10S,13R)-7-(3-aminopropanoyloxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | CCCCCCCCCCOC(=O)CC[C@@H](C)C1CCC2[C@H]3C(CC[C@@]21C)[C@@]1(C)CCCC[C@H]1C[C@H]3OC(=O)CCN |
| InChI | InChI=1S/C37H65NO4/c1-5-6-7-8-9-10-11-14-25-41-33(39)19-16-27(2)29-17-18-30-35-31(20-23-37(29,30)4)36(3)22-13-12-15-28(36)26-32(35)42-34(40)21-24-38/h27-32,35H,5-26,38H2,1-4H3/t27-,28+,29?,30?,31?,32-,35+,36+,37-/m1/s1 |
| InChIKey | APTCHFFYLPXSOX-XMJMURKNSA-N |
| XLogP | 9.01 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.93 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|