C20H24N2O6S — CID 123732711
propan-2-yl N-[2-[(6-methoxy-2H-chromene-3-carbonyl)amino]thiolane-3-carbonyl]carbamate (PubChem CID 123732711) has the molecular formula C20H24N2O6S and a molecular weight of 420.49 g/mol. Its IUPAC name is propan-2-yl N-[2-[(6-methoxy-2H-chromene-3-carbonyl)amino]thiolane-3-carbonyl]carbamate.
| Compound Name | propan-2-yl N-[2-[(6-methoxy-2H-chromene-3-carbonyl)amino]thiolane-3-carbonyl]carbamate |
|---|---|
| PubChem CID | 123732711 |
| Molecular Formula | C20H24N2O6S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | propan-2-yl N-[2-[(6-methoxy-2H-chromene-3-carbonyl)amino]thiolane-3-carbonyl]carbamate |
| SMILES | COc1ccc2c(c1)C=C(C(=O)NC1SCCC1C(=O)NC(=O)OC(C)C)CO2 |
| InChI | InChI=1S/C20H24N2O6S/c1-11(2)28-20(25)22-18(24)15-6-7-29-19(15)21-17(23)13-8-12-9-14(26-3)4-5-16(12)27-10-13/h4-5,8-9,11,15,19H,6-7,10H2,1-3H3,(H,21,23)(H,22,24,25) |
| InChIKey | XLCDZJJWPTZVIH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |