C18H19NO4 — CID 92713356
N-[(2R)-1-(furan-2-yl)propan-2-yl]-6-methoxy-2H-chromene-3-carboxamide (PubChem CID 92713356) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is N-[(2R)-1-(furan-2-yl)propan-2-yl]-6-methoxy-2H-chromene-3-carboxamide.
| Compound Name | N-[(2R)-1-(furan-2-yl)propan-2-yl]-6-methoxy-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 92713356 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | N-[(2R)-1-(furan-2-yl)propan-2-yl]-6-methoxy-2H-chromene-3-carboxamide |
| SMILES | COc1ccc2c(c1)C=C(C(=O)N[C@H](C)Cc1ccco1)CO2 |
| InChI | InChI=1S/C18H19NO4/c1-12(8-16-4-3-7-22-16)19-18(20)14-9-13-10-15(21-2)5-6-17(13)23-11-14/h3-7,9-10,12H,8,11H2,1-2H3,(H,19,20)/t12-/m1/s1 |
| InChIKey | WVCJHCAHFYAEIJ-GFCCVEGCSA-N |
| XLogP | 2.81 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |