C21H23F5N6O3S — CID 123734093
3-(hydroxymethyl)-1-[[6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-(2,2,3,3,3-pentafluoropropylamino)pyrimidin-4-yl]amino]cyclopentane-1,2-diol (PubChem CID 123734093) has the molecular formula C21H23F5N6O3S and a molecular weight of 534.51 g/mol. Its IUPAC name is 3-(hydroxymethyl)-1-[[6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-(2,2,3,3,3-pentafluoropropylamino)pyrimidin-4-yl]amino]cyclopentane-1,2-diol.
| Compound Name | 3-(hydroxymethyl)-1-[[6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-(2,2,3,3,3-pentafluoropropylamino)pyrimidin-4-yl]amino]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 123734093 |
| Molecular Formula | C21H23F5N6O3S |
| Molecular Weight | 534.51 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | 3-(hydroxymethyl)-1-[[6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-(2,2,3,3,3-pentafluoropropylamino)pyrimidin-4-yl]amino]cyclopentane-1,2-diol |
| SMILES | Cc1nc(NCC(F)(F)C(F)(F)F)nc(NC2(O)CCC(CO)C2O)c1-c1nc2c(C)nccc2s1 |
| InChI | InChI=1S/C21H23F5N6O3S/c1-9-13(17-30-14-10(2)27-6-4-12(14)36-17)16(32-19(35)5-3-11(7-33)15(19)34)31-18(29-9)28-8-20(22,23)21(24,25)26/h4,6,11,15,33-35H,3,5,7-8H2,1-2H3,(H2,28,29,31,32) |
| InChIKey | GQTQTNIYOTXSHC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 136.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|