C21H25F3N6O3S — CID 143945454
(1R,2R,3R)-3-(hydroxymethyl)-1-[[6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]pyrimidin-4-yl]amino]cyclopentane-1,2-diol (PubChem CID 143945454) has the molecular formula C21H25F3N6O3S and a molecular weight of 498.53 g/mol. Its IUPAC name is (1R,2R,3R)-3-(hydroxymethyl)-1-[[6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]pyrimidin-4-yl]amino]cyclopentane-1,2-diol.
| Compound Name | (1R,2R,3R)-3-(hydroxymethyl)-1-[[6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]pyrimidin-4-yl]amino]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 143945454 |
| Molecular Formula | C21H25F3N6O3S |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | (1R,2R,3R)-3-(hydroxymethyl)-1-[[6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]pyrimidin-4-yl]amino]cyclopentane-1,2-diol |
| SMILES | Cc1nc(N[C@H](C)C(F)(F)F)nc(N[C@@]2(O)CC[C@H](CO)[C@H]2O)c1-c1nc2c(C)nccc2s1 |
| InChI | InChI=1S/C21H25F3N6O3S/c1-9-14(18-28-15-10(2)25-7-5-13(15)34-18)17(29-19(26-9)27-11(3)21(22,23)24)30-20(33)6-4-12(8-31)16(20)32/h5,7,11-12,16,31-33H,4,6,8H2,1-3H3,(H2,26,27,29,30)/t11-,12-,16-,20-/m1/s1 |
| InChIKey | LRKXSCRARSKKPO-VIIZEREPSA-N |
| XLogP | 2.99 |
| TPSA | 136.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|