C12H23NO — CID 123734166
(3,3-dimethylpent-4-en-2-ylamino)-(1-methylcyclopropyl)methanol (PubChem CID 123734166) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is (3,3-dimethylpent-4-en-2-ylamino)-(1-methylcyclopropyl)methanol.
| Compound Name | (3,3-dimethylpent-4-en-2-ylamino)-(1-methylcyclopropyl)methanol |
|---|---|
| PubChem CID | 123734166 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | (3,3-dimethylpent-4-en-2-ylamino)-(1-methylcyclopropyl)methanol |
| SMILES | C=CC(C)(C)C(C)NC(O)C1(C)CC1 |
| InChI | InChI=1S/C12H23NO/c1-6-11(3,4)9(2)13-10(14)12(5)7-8-12/h6,9-10,13-14H,1,7-8H2,2-5H3 |
| InChIKey | SKVPMAJAQUBWEU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|