C21H30O3 — CID 123735598
9,15-dimethyl-3-methylidene-5,8-dioxatetracyclo[11.5.2.02,6.07,9]icos-12-en-4-one (PubChem CID 123735598) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is 9,15-dimethyl-3-methylidene-5,8-dioxatetracyclo[11.5.2.02,6.07,9]icos-12-en-4-one.
| Compound Name | 9,15-dimethyl-3-methylidene-5,8-dioxatetracyclo[11.5.2.02,6.07,9]icos-12-en-4-one |
|---|---|
| PubChem CID | 123735598 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 9,15-dimethyl-3-methylidene-5,8-dioxatetracyclo[11.5.2.02,6.07,9]icos-12-en-4-one |
| SMILES | C=C1C(=O)OC2C1C1CCCC(C)CC(=CCCC3(C)OC23)CC1 |
| InChI | InChI=1S/C21H30O3/c1-13-6-4-8-16-10-9-15(12-13)7-5-11-21(3)19(24-21)18-17(16)14(2)20(22)23-18/h7,13,16-19H,2,4-6,8-12H2,1,3H3 |
| InChIKey | YURTUGGKFPNLQN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|