C31H37FN6O3 — CID 123738268
2-[2-[(4-cyclohexylphenyl)methyl-[(2-methylpropan-2-yl)oxymethyl]amino]-6-(4-fluoroanilino)purin-9-yl]acetic acid (PubChem CID 123738268) has the molecular formula C31H37FN6O3 and a molecular weight of 560.67 g/mol. Its IUPAC name is 2-[2-[(4-cyclohexylphenyl)methyl-[(2-methylpropan-2-yl)oxymethyl]amino]-6-(4-fluoroanilino)purin-9-yl]acetic acid.
| Compound Name | 2-[2-[(4-cyclohexylphenyl)methyl-[(2-methylpropan-2-yl)oxymethyl]amino]-6-(4-fluoroanilino)purin-9-yl]acetic acid |
|---|---|
| PubChem CID | 123738268 |
| Molecular Formula | C31H37FN6O3 |
| Molecular Weight | 560.67 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | 2-[2-[(4-cyclohexylphenyl)methyl-[(2-methylpropan-2-yl)oxymethyl]amino]-6-(4-fluoroanilino)purin-9-yl]acetic acid |
| SMILES | CC(C)(C)OCN(Cc1ccc(C2CCCCC2)cc1)c1nc(Nc2ccc(F)cc2)c2ncn(CC(=O)O)c2n1 |
| InChI | InChI=1S/C31H37FN6O3/c1-31(2,3)41-20-38(17-21-9-11-23(12-10-21)22-7-5-4-6-8-22)30-35-28(34-25-15-13-24(32)14-16-25)27-29(36-30)37(19-33-27)18-26(39)40/h9-16,19,22H,4-8,17-18,20H2,1-3H3,(H,39,40)(H,34,35,36) |
| InChIKey | LJQBSFDMICDVRH-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.67 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|