C33H26ClF3N2O4S2 — CID 123741579
[[(Z)-4-(4-chlorophenyl)sulfanyl-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-1-oxobut-2-en-2-yl]amino] trifluoromethanesulfinate (PubChem CID 123741579) has the molecular formula C33H26ClF3N2O4S2 and a molecular weight of 671.16 g/mol. Its IUPAC name is [[(Z)-4-(4-chlorophenyl)sulfanyl-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-1-oxobut-2-en-2-yl]amino] trifluoromethanesulfinate.
| Compound Name | [[(Z)-4-(4-chlorophenyl)sulfanyl-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-1-oxobut-2-en-2-yl]amino] trifluoromethanesulfinate |
|---|---|
| PubChem CID | 123741579 |
| Molecular Formula | C33H26ClF3N2O4S2 |
| Molecular Weight | 671.16 g/mol |
| Exact Mass | 670.10 |
| IUPAC Name | [[(Z)-4-(4-chlorophenyl)sulfanyl-1-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]-1-oxobut-2-en-2-yl]amino] trifluoromethanesulfinate |
| SMILES | CCn1c2ccc(C(=O)/C(=C/CSc3ccc(Cl)cc3)NOS(=O)C(F)(F)F)cc2c2cc(C(=O)c3ccccc3C)ccc21 |
| InChI | InChI=1S/C33H26ClF3N2O4S2/c1-3-39-29-14-8-21(31(40)25-7-5-4-6-20(25)2)18-26(29)27-19-22(9-15-30(27)39)32(41)28(38-43-45(42)33(35,36)37)16-17-44-24-12-10-23(34)11-13-24/h4-16,18-19,38H,3,17H2,1-2H3/b28-16- |
| InChIKey | YDCOMNUUEHJYTR-NTFVMDSBSA-N |
| XLogP | 8.57 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.16 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|