C34H32ClN2O3S+ — CID 162773324
acetyloxymethylidene-[3-(4-chlorophenyl)sulfanylpropyl]-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]azanium (PubChem CID 162773324) has the molecular formula C34H32ClN2O3S+ and a molecular weight of 584.16 g/mol. Its IUPAC name is acetyloxymethylidene-[3-(4-chlorophenyl)sulfanylpropyl]-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]azanium.
| Compound Name | acetyloxymethylidene-[3-(4-chlorophenyl)sulfanylpropyl]-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]azanium |
|---|---|
| PubChem CID | 162773324 |
| Molecular Formula | C34H32ClN2O3S+ |
| Molecular Weight | 584.16 g/mol |
| Exact Mass | 583.18 |
| IUPAC Name | acetyloxymethylidene-[3-(4-chlorophenyl)sulfanylpropyl]-[9-ethyl-6-(2-methylbenzoyl)carbazol-3-yl]azanium |
| SMILES | CCn1c2ccc(C(=O)c3ccccc3C)cc2c2cc(/[N+](=C/OC(C)=O)CCCSc3ccc(Cl)cc3)ccc21 |
| InChI | InChI=1S/C34H32ClN2O3S/c1-4-37-32-16-10-25(34(39)29-9-6-5-8-23(29)2)20-30(32)31-21-27(13-17-33(31)37)36(22-40-24(3)38)18-7-19-41-28-14-11-26(35)12-15-28/h5-6,8-17,20-22H,4,7,18-19H2,1-3H3/q+1/b36-22+ |
| InChIKey | WDEJVPDLVMKOLH-HPNXWYHWSA-N |
| XLogP | 8.43 |
| TPSA | 51.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.16 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|