C22H23ClFN5O2 — CID 123742003
N-[[2'-amino-6-(3-chloro-5-fluorophenyl)-1',2-dimethyl-5'-oxospiro[3H-chromene-4,4'-imidazole]-2-yl]methyl]-N-methylmethanimidamide (PubChem CID 123742003) has the molecular formula C22H23ClFN5O2 and a molecular weight of 443.91 g/mol. Its IUPAC name is N-[[2'-amino-6-(3-chloro-5-fluorophenyl)-1',2-dimethyl-5'-oxospiro[3H-chromene-4,4'-imidazole]-2-yl]methyl]-N-methylmethanimidamide.
| Compound Name | N-[[2'-amino-6-(3-chloro-5-fluorophenyl)-1',2-dimethyl-5'-oxospiro[3H-chromene-4,4'-imidazole]-2-yl]methyl]-N-methylmethanimidamide |
|---|---|
| PubChem CID | 123742003 |
| Molecular Formula | C22H23ClFN5O2 |
| Molecular Weight | 443.91 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | N-[[2'-amino-6-(3-chloro-5-fluorophenyl)-1',2-dimethyl-5'-oxospiro[3H-chromene-4,4'-imidazole]-2-yl]methyl]-N-methylmethanimidamide |
| SMILES | [H]/N=C/N(C)CC1(C)CC2(N=C(N)N(C)C2=O)c2cc(-c3cc(F)cc(Cl)c3)ccc2O1 |
| InChI | InChI=1S/C22H23ClFN5O2/c1-21(11-28(2)12-25)10-22(19(30)29(3)20(26)27-22)17-8-13(4-5-18(17)31-21)14-6-15(23)9-16(24)7-14/h4-9,12,25H,10-11H2,1-3H3,(H2,26,27)/b25-12+ |
| InChIKey | ILGJODCMGJAWRN-BRJLIKDPSA-N |
| XLogP | 3.21 |
| TPSA | 95.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.91 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|