C22H20ClFN4O2 — CID 123743380
3-(8-chloroimidazo[1,2-a]pyridin-2-yl)-7-(3,5-dimethylpiperazin-1-yl)-5-fluorochromen-2-one (PubChem CID 123743380) has the molecular formula C22H20ClFN4O2 and a molecular weight of 426.88 g/mol. Its IUPAC name is 3-(8-chloroimidazo[1,2-a]pyridin-2-yl)-7-(3,5-dimethylpiperazin-1-yl)-5-fluorochromen-2-one.
| Compound Name | 3-(8-chloroimidazo[1,2-a]pyridin-2-yl)-7-(3,5-dimethylpiperazin-1-yl)-5-fluorochromen-2-one |
|---|---|
| PubChem CID | 123743380 |
| Molecular Formula | C22H20ClFN4O2 |
| Molecular Weight | 426.88 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 3-(8-chloroimidazo[1,2-a]pyridin-2-yl)-7-(3,5-dimethylpiperazin-1-yl)-5-fluorochromen-2-one |
| SMILES | CC1CN(c2cc(F)c3cc(-c4cn5cccc(Cl)c5n4)c(=O)oc3c2)CC(C)N1 |
| InChI | InChI=1S/C22H20ClFN4O2/c1-12-9-28(10-13(2)25-12)14-6-18(24)15-8-16(22(29)30-20(15)7-14)19-11-27-5-3-4-17(23)21(27)26-19/h3-8,11-13,25H,9-10H2,1-2H3 |
| InChIKey | MXMCVFLYQKYUQP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 62.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.88 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|