C25H47N5O5 — CID 123743463
[N'-[3-(dimethylamino)propyl]-N-ethylcarbamimidoyl] 3-[[2-[1-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexyl]acetyl]amino]propanoate (PubChem CID 123743463) has the molecular formula C25H47N5O5 and a molecular weight of 497.68 g/mol. Its IUPAC name is [N'-[3-(dimethylamino)propyl]-N-ethylcarbamimidoyl] 3-[[2-[1-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexyl]acetyl]amino]propanoate.
| Compound Name | [N'-[3-(dimethylamino)propyl]-N-ethylcarbamimidoyl] 3-[[2-[1-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexyl]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 123743463 |
| Molecular Formula | C25H47N5O5 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.36 |
| IUPAC Name | [N'-[3-(dimethylamino)propyl]-N-ethylcarbamimidoyl] 3-[[2-[1-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexyl]acetyl]amino]propanoate |
| SMILES | CCN/C(=N\CCCN(C)C)OC(=O)CCNC(=O)CC1(CNC(=O)OC(C)(C)C)CCCCC1 |
| InChI | InChI=1S/C25H47N5O5/c1-7-26-22(28-15-11-17-30(5)6)34-21(32)12-16-27-20(31)18-25(13-9-8-10-14-25)19-29-23(33)35-24(2,3)4/h7-19H2,1-6H3,(H,26,28)(H,27,31)(H,29,33) |
| InChIKey | JOOPVDWATNAMRB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|