C8H18NO4P — CID 123743586
2-hydroxypropan-2-yl(pyrrolidin-2-ylmethoxy)phosphinic acid (PubChem CID 123743586) has the molecular formula C8H18NO4P and a molecular weight of 223.21 g/mol. Its IUPAC name is 2-hydroxypropan-2-yl(pyrrolidin-2-ylmethoxy)phosphinic acid.
| Compound Name | 2-hydroxypropan-2-yl(pyrrolidin-2-ylmethoxy)phosphinic acid |
|---|---|
| PubChem CID | 123743586 |
| Molecular Formula | C8H18NO4P |
| Molecular Weight | 223.21 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 2-hydroxypropan-2-yl(pyrrolidin-2-ylmethoxy)phosphinic acid |
| SMILES | CC(C)(O)P(=O)(O)OCC1CCCN1 |
| InChI | InChI=1S/C8H18NO4P/c1-8(2,10)14(11,12)13-6-7-4-3-5-9-7/h7,9-10H,3-6H2,1-2H3,(H,11,12) |
| InChIKey | JVQBXDVUMFXDKC-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.21 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|