C20H18ClF3N4O2 — CID 123744641
3-(chloromethyl)-4-[4-methyl-5-[2-(2,4,6-trifluorophenoxy)propan-2-yl]-1,2,4-triazol-3-yl]benzamide (PubChem CID 123744641) has the molecular formula C20H18ClF3N4O2 and a molecular weight of 438.84 g/mol. Its IUPAC name is 3-(chloromethyl)-4-[4-methyl-5-[2-(2,4,6-trifluorophenoxy)propan-2-yl]-1,2,4-triazol-3-yl]benzamide.
| Compound Name | 3-(chloromethyl)-4-[4-methyl-5-[2-(2,4,6-trifluorophenoxy)propan-2-yl]-1,2,4-triazol-3-yl]benzamide |
|---|---|
| PubChem CID | 123744641 |
| Molecular Formula | C20H18ClF3N4O2 |
| Molecular Weight | 438.84 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 3-(chloromethyl)-4-[4-methyl-5-[2-(2,4,6-trifluorophenoxy)propan-2-yl]-1,2,4-triazol-3-yl]benzamide |
| SMILES | Cn1c(-c2ccc(C(N)=O)cc2CCl)nnc1C(C)(C)Oc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C20H18ClF3N4O2/c1-20(2,30-16-14(23)7-12(22)8-15(16)24)19-27-26-18(28(19)3)13-5-4-10(17(25)29)6-11(13)9-21/h4-8H,9H2,1-3H3,(H2,25,29) |
| InChIKey | YDQBGKMIZCEFIY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.84 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|