C19H19F3N4O — CID 70247155
4-[4-ethyl-5-[2-(2,4,6-trifluorophenoxy)propan-2-yl]-1,2,4-triazol-3-yl]aniline (PubChem CID 70247155) has the molecular formula C19H19F3N4O and a molecular weight of 376.38 g/mol. Its IUPAC name is 4-[4-ethyl-5-[2-(2,4,6-trifluorophenoxy)propan-2-yl]-1,2,4-triazol-3-yl]aniline.
| Compound Name | 4-[4-ethyl-5-[2-(2,4,6-trifluorophenoxy)propan-2-yl]-1,2,4-triazol-3-yl]aniline |
|---|---|
| PubChem CID | 70247155 |
| Molecular Formula | C19H19F3N4O |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 4-[4-ethyl-5-[2-(2,4,6-trifluorophenoxy)propan-2-yl]-1,2,4-triazol-3-yl]aniline |
| SMILES | CCn1c(-c2ccc(N)cc2)nnc1C(C)(C)Oc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C19H19F3N4O/c1-4-26-17(11-5-7-13(23)8-6-11)24-25-18(26)19(2,3)27-16-14(21)9-12(20)10-15(16)22/h5-10H,4,23H2,1-3H3 |
| InChIKey | JSSIHMUVEIPEPV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|