C12H19NO2 — CID 123744849
5-methyl-3-pent-4-enyl-4-prop-2-enyl-1,3-oxazolidin-2-one (PubChem CID 123744849) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 5-methyl-3-pent-4-enyl-4-prop-2-enyl-1,3-oxazolidin-2-one.
| Compound Name | 5-methyl-3-pent-4-enyl-4-prop-2-enyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 123744849 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 5-methyl-3-pent-4-enyl-4-prop-2-enyl-1,3-oxazolidin-2-one |
| SMILES | C=CCCCN1C(=O)OC(C)C1CC=C |
| InChI | InChI=1S/C12H19NO2/c1-4-6-7-9-13-11(8-5-2)10(3)15-12(13)14/h4-5,10-11H,1-2,6-9H2,3H3 |
| InChIKey | DHGFDVYPWOBPEC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|