C13H22F5NO2S — CID 123745276
2-[4-(4,4,5,5,5-pentafluoropentylsulfonyl)butyl]pyrrolidine (PubChem CID 123745276) has the molecular formula C13H22F5NO2S and a molecular weight of 351.38 g/mol. Its IUPAC name is 2-[4-(4,4,5,5,5-pentafluoropentylsulfonyl)butyl]pyrrolidine.
| Compound Name | 2-[4-(4,4,5,5,5-pentafluoropentylsulfonyl)butyl]pyrrolidine |
|---|---|
| PubChem CID | 123745276 |
| Molecular Formula | C13H22F5NO2S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 2-[4-(4,4,5,5,5-pentafluoropentylsulfonyl)butyl]pyrrolidine |
| SMILES | O=S(=O)(CCCCC1CCCN1)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H22F5NO2S/c14-12(15,13(16,17)18)7-4-10-22(20,21)9-2-1-5-11-6-3-8-19-11/h11,19H,1-10H2 |
| InChIKey | LUPXORDJCNLLKA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|