C12H20F5N — CID 86666688
(2R)-2-(7,7,8,8,8-pentafluorooctyl)pyrrolidine (PubChem CID 86666688) has the molecular formula C12H20F5N and a molecular weight of 273.29 g/mol. Its IUPAC name is (2R)-2-(7,7,8,8,8-pentafluorooctyl)pyrrolidine.
| Compound Name | (2R)-2-(7,7,8,8,8-pentafluorooctyl)pyrrolidine |
|---|---|
| PubChem CID | 86666688 |
| Molecular Formula | C12H20F5N |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | (2R)-2-(7,7,8,8,8-pentafluorooctyl)pyrrolidine |
| SMILES | FC(F)(F)C(F)(F)CCCCCC[C@@H]1CCCN1 |
| InChI | InChI=1S/C12H20F5N/c13-11(14,12(15,16)17)8-4-2-1-3-6-10-7-5-9-18-10/h10,18H,1-9H2/t10-/m1/s1 |
| InChIKey | ZRVNRVAIEDDVLI-SNVBAGLBSA-N |
| XLogP | 4.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|