C21H23F6N7O2S — CID 123745880
3-methyl-5-[[2-(trifluoromethyl)-2,3-dihydropyrazin-5-yl]amino]-N-[6-[3-(3,3,3-trifluoropropylamino)propoxy]-3-pyridinyl]-1,2-thiazole-4-carboxamide (PubChem CID 123745880) has the molecular formula C21H23F6N7O2S and a molecular weight of 551.52 g/mol. Its IUPAC name is 3-methyl-5-[[2-(trifluoromethyl)-2,3-dihydropyrazin-5-yl]amino]-N-[6-[3-(3,3,3-trifluoropropylamino)propoxy]-3-pyridinyl]-1,2-thiazole-4-carboxamide.
| Compound Name | 3-methyl-5-[[2-(trifluoromethyl)-2,3-dihydropyrazin-5-yl]amino]-N-[6-[3-(3,3,3-trifluoropropylamino)propoxy]-3-pyridinyl]-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 123745880 |
| Molecular Formula | C21H23F6N7O2S |
| Molecular Weight | 551.52 g/mol |
| Exact Mass | 551.15 |
| IUPAC Name | 3-methyl-5-[[2-(trifluoromethyl)-2,3-dihydropyrazin-5-yl]amino]-N-[6-[3-(3,3,3-trifluoropropylamino)propoxy]-3-pyridinyl]-1,2-thiazole-4-carboxamide |
| SMILES | Cc1nsc(NC2=NCC(C(F)(F)F)N=C2)c1C(=O)Nc1ccc(OCCCNCCC(F)(F)F)nc1 |
| InChI | InChI=1S/C21H23F6N7O2S/c1-12-17(19(37-34-12)33-15-11-29-14(10-30-15)21(25,26)27)18(35)32-13-3-4-16(31-9-13)36-8-2-6-28-7-5-20(22,23)24/h3-4,9,11,14,28H,2,5-8,10H2,1H3,(H,30,33)(H,32,35) |
| InChIKey | ZRECUNYUNSVLSN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 112.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|