C18H18F3N7O2S — CID 118285134
N-[6-(3-aminopropoxy)-3-pyridinyl]-3-methyl-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-1,2-thiazole-4-carboxamide (PubChem CID 118285134) has the molecular formula C18H18F3N7O2S and a molecular weight of 453.45 g/mol. Its IUPAC name is N-[6-(3-aminopropoxy)-3-pyridinyl]-3-methyl-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-1,2-thiazole-4-carboxamide.
| Compound Name | N-[6-(3-aminopropoxy)-3-pyridinyl]-3-methyl-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 118285134 |
| Molecular Formula | C18H18F3N7O2S |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | N-[6-(3-aminopropoxy)-3-pyridinyl]-3-methyl-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-1,2-thiazole-4-carboxamide |
| SMILES | Cc1nsc(Nc2cncc(C(F)(F)F)n2)c1C(=O)Nc1ccc(OCCCN)nc1 |
| InChI | InChI=1S/C18H18F3N7O2S/c1-10-15(16(29)25-11-3-4-14(24-7-11)30-6-2-5-22)17(31-28-10)27-13-9-23-8-12(26-13)18(19,20)21/h3-4,7-9H,2,5-6,22H2,1H3,(H,25,29)(H,26,27) |
| InChIKey | PQLNBIJDNPAORL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 127.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|