C21H18N6O2S — CID 129059832
3-methyl-N-(6-prop-2-enoxy-3-pyridinyl)-5-(quinoxalin-2-ylamino)-1,2-thiazole-4-carboxamide (PubChem CID 129059832) has the molecular formula C21H18N6O2S and a molecular weight of 418.48 g/mol. Its IUPAC name is 3-methyl-N-(6-prop-2-enoxy-3-pyridinyl)-5-(quinoxalin-2-ylamino)-1,2-thiazole-4-carboxamide.
| Compound Name | 3-methyl-N-(6-prop-2-enoxy-3-pyridinyl)-5-(quinoxalin-2-ylamino)-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 129059832 |
| Molecular Formula | C21H18N6O2S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 3-methyl-N-(6-prop-2-enoxy-3-pyridinyl)-5-(quinoxalin-2-ylamino)-1,2-thiazole-4-carboxamide |
| SMILES | C=CCOc1ccc(NC(=O)c2c(C)nsc2Nc2cnc3ccccc3n2)cn1 |
| InChI | InChI=1S/C21H18N6O2S/c1-3-10-29-18-9-8-14(11-23-18)24-20(28)19-13(2)27-30-21(19)26-17-12-22-15-6-4-5-7-16(15)25-17/h3-9,11-12H,1,10H2,2H3,(H,24,28)(H,25,26) |
| InChIKey | WBRADPPOYBOCLT-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 101.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|