C26H50 — CID 123746392
2-(2,3,3,4,4,5-hexamethylhexan-2-yl)-1,2,3,6-tetramethyl-5-(2-methylpropyl)bicyclo[2.2.0]hexane (PubChem CID 123746392) has the molecular formula C26H50 and a molecular weight of 362.69 g/mol. Its IUPAC name is 2-(2,3,3,4,4,5-hexamethylhexan-2-yl)-1,2,3,6-tetramethyl-5-(2-methylpropyl)bicyclo[2.2.0]hexane.
| Compound Name | 2-(2,3,3,4,4,5-hexamethylhexan-2-yl)-1,2,3,6-tetramethyl-5-(2-methylpropyl)bicyclo[2.2.0]hexane |
|---|---|
| PubChem CID | 123746392 |
| Molecular Formula | C26H50 |
| Molecular Weight | 362.69 g/mol |
| Exact Mass | 362.39 |
| IUPAC Name | 2-(2,3,3,4,4,5-hexamethylhexan-2-yl)-1,2,3,6-tetramethyl-5-(2-methylpropyl)bicyclo[2.2.0]hexane |
| SMILES | CC(C)CC1C(C)C2(C)C1C(C)C2(C)C(C)(C)C(C)(C)C(C)(C)C(C)C |
| InChI | InChI=1S/C26H50/c1-16(2)15-20-18(5)25(13)21(20)19(6)26(25,14)24(11,12)23(9,10)22(7,8)17(3)4/h16-21H,15H2,1-14H3 |
| InChIKey | WLFQXSGZNVJSIG-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.69 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |