C9H18N2O7P2 — CID 123747026
[1-hydroxy-5-(2-methylimidazol-1-yl)-1-phosphonopentyl]phosphonic acid (PubChem CID 123747026) has the molecular formula C9H18N2O7P2 and a molecular weight of 328.20 g/mol. Its IUPAC name is [1-hydroxy-5-(2-methylimidazol-1-yl)-1-phosphonopentyl]phosphonic acid.
| Compound Name | [1-hydroxy-5-(2-methylimidazol-1-yl)-1-phosphonopentyl]phosphonic acid |
|---|---|
| PubChem CID | 123747026 |
| Molecular Formula | C9H18N2O7P2 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | [1-hydroxy-5-(2-methylimidazol-1-yl)-1-phosphonopentyl]phosphonic acid |
| SMILES | Cc1nccn1CCCCC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C9H18N2O7P2/c1-8-10-5-7-11(8)6-3-2-4-9(12,19(13,14)15)20(16,17)18/h5,7,12H,2-4,6H2,1H3,(H2,13,14,15)(H2,16,17,18) |
| InChIKey | XVCXRWCPUGHUKG-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 153.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|