C21H38 — CID 123747490
1,4-bis(3-methylpentan-3-yl)cyclonona-1,3-diene (PubChem CID 123747490) has the molecular formula C21H38 and a molecular weight of 290.54 g/mol. Its IUPAC name is 1,4-bis(3-methylpentan-3-yl)cyclonona-1,3-diene.
| Compound Name | 1,4-bis(3-methylpentan-3-yl)cyclonona-1,3-diene |
|---|---|
| PubChem CID | 123747490 |
| Molecular Formula | C21H38 |
| Molecular Weight | 290.54 g/mol |
| Exact Mass | 290.30 |
| IUPAC Name | 1,4-bis(3-methylpentan-3-yl)cyclonona-1,3-diene |
| SMILES | CCC(C)(CC)C1=CC=C(C(C)(CC)CC)CCCCC1 |
| InChI | InChI=1S/C21H38/c1-7-20(5,8-2)18-14-12-11-13-15-19(17-16-18)21(6,9-3)10-4/h16-17H,7-15H2,1-6H3 |
| InChIKey | CNOSRRPVBNRTRX-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.54 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |