C25H22F2N5O2- — CID 123747897
CID 123747897 (PubChem CID 123747897) has the molecular formula C25H22F2N5O2- and a molecular weight of 462.48 g/mol.
| Compound Name | CID 123747897 |
|---|---|
| PubChem CID | 123747897 |
| Molecular Formula | C25H22F2N5O2- |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | — |
| SMILES | [CH2-]n1c2c(c3ccc(-n4ccc(OCc5ncc(F)cc5F)cc4=O)nc31)CN1CCCC1C2 |
| InChI | InChI=1S/C25H22F2N5O2/c1-30-22-10-16-3-2-7-31(16)13-19(22)18-4-5-23(29-25(18)30)32-8-6-17(11-24(32)33)34-14-21-20(27)9-15(26)12-28-21/h4-6,8-9,11-12,16H,1-3,7,10,13-14H2/q-1 |
| InChIKey | ROMPMJUMPXQFAS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 65.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|