C13H6F6N2O2S — CID 123747904
4-(trifluoromethyl)-N-[5-(trifluoromethyl)thiophene-2-carbonyl]pyridine-3-carboxamide (PubChem CID 123747904) has the molecular formula C13H6F6N2O2S and a molecular weight of 368.26 g/mol. Its IUPAC name is 4-(trifluoromethyl)-N-[5-(trifluoromethyl)thiophene-2-carbonyl]pyridine-3-carboxamide.
| Compound Name | 4-(trifluoromethyl)-N-[5-(trifluoromethyl)thiophene-2-carbonyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 123747904 |
| Molecular Formula | C13H6F6N2O2S |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | 4-(trifluoromethyl)-N-[5-(trifluoromethyl)thiophene-2-carbonyl]pyridine-3-carboxamide |
| SMILES | O=C(NC(=O)c1cnccc1C(F)(F)F)c1ccc(C(F)(F)F)s1 |
| InChI | InChI=1S/C13H6F6N2O2S/c14-12(15,16)7-3-4-20-5-6(7)10(22)21-11(23)8-1-2-9(24-8)13(17,18)19/h1-5H,(H,21,22,23) |
| InChIKey | OEFZFJIMHYITLT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|