C10H13F3N2OSi — CID 170555219
4-(trifluoromethyl)-N-trimethylsilylpyridine-3-carboxamide (PubChem CID 170555219) has the molecular formula C10H13F3N2OSi and a molecular weight of 262.31 g/mol. Its IUPAC name is 4-(trifluoromethyl)-N-trimethylsilylpyridine-3-carboxamide.
| Compound Name | 4-(trifluoromethyl)-N-trimethylsilylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 170555219 |
| Molecular Formula | C10H13F3N2OSi |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 4-(trifluoromethyl)-N-trimethylsilylpyridine-3-carboxamide |
| SMILES | C[Si](C)(C)NC(=O)c1cnccc1C(F)(F)F |
| InChI | InChI=1S/C10H13F3N2OSi/c1-17(2,3)15-9(16)7-6-14-5-4-8(7)10(11,12)13/h4-6H,1-3H3,(H,15,16) |
| InChIKey | TYGUVHFVYHJUDA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|