C13H13F6N3O — CID 139983759
4-(trifluoromethyl)-N'-(1,1,1-trifluoro-2-methylpent-4-en-2-yl)pyridine-3-carbohydrazide (PubChem CID 139983759) has the molecular formula C13H13F6N3O and a molecular weight of 341.26 g/mol. Its IUPAC name is 4-(trifluoromethyl)-N'-(1,1,1-trifluoro-2-methylpent-4-en-2-yl)pyridine-3-carbohydrazide.
| Compound Name | 4-(trifluoromethyl)-N'-(1,1,1-trifluoro-2-methylpent-4-en-2-yl)pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 139983759 |
| Molecular Formula | C13H13F6N3O |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 4-(trifluoromethyl)-N'-(1,1,1-trifluoro-2-methylpent-4-en-2-yl)pyridine-3-carbohydrazide |
| SMILES | C=CCC(C)(NNC(=O)c1cnccc1C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H13F6N3O/c1-3-5-11(2,13(17,18)19)22-21-10(23)8-7-20-6-4-9(8)12(14,15)16/h3-4,6-7,22H,1,5H2,2H3,(H,21,23) |
| InChIKey | FPZXJTSSZYJQRX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|